CAS 28006-96-4 is the registry number for 5-Bromo-2-hydroxy-3,4-dimethoxybenzaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
5-bromo-2-hydroxy-3,4-dimethoxybenzaldehyde (CAS 28006-96-4) is a chemical compound with the molecular formula C9H9BrO4 and a molecular weight of 261.07 g/mol. IUPAC name: 5-bromo-2-hydroxy-3,4-dimethoxybenzaldehyde. InChIKey: KCBQLFJRBALMEC-UHFFFAOYSA-N.
| Molecular formula | C9H9BrO4 |
|---|---|
| Molecular weight | 261.07 g/mol |
| IUPAC name | 5-bromo-2-hydroxy-3,4-dimethoxybenzaldehyde |
| InChIKey | KCBQLFJRBALMEC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1OC)O)C=O)Br |
Computed by PubChem (NCBI)