CAS 28333-76-8 appears in our catalog under these names: 4-(Aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride, 95%, 4-(aminomethyl)bicyclo(2.2.1)heptane-1-carboxylic acid hydrochloride, 98%, 4-(aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g, 500mg, 10g.
4-(aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride (CAS 28333-76-8) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 4-(aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride. InChIKey: SKAZVSMWOXAGDW-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 4-(aminomethyl)bicyclo[2.2.1]heptane-1-carboxylic acid;hydrochloride |
| InChIKey | SKAZVSMWOXAGDW-UHFFFAOYSA-N |
| SMILES | C1CC2(CCC1(C2)CN)C(=O)O.Cl |
Computed by PubChem (NCBI)