CAS 2841541-44-2 is the registry number for (R)-2-(6-Chloro-2,3-dihydrobenzofuran-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[(3R)-6-chloro-2,3-dihydro-1-benzofuran-3-yl]acetic acid (CAS 2841541-44-2) is a chemical compound with the molecular formula C10H9ClO3 and a molecular weight of 212.63 g/mol. IUPAC name: 2-[(3R)-6-chloro-2,3-dihydro-1-benzofuran-3-yl]acetic acid. InChIKey: UFDNMYNCYATWIB-LURJTMIESA-N.
| Molecular formula | C10H9ClO3 |
|---|---|
| Molecular weight | 212.63 g/mol |
| IUPAC name | 2-[(3R)-6-chloro-2,3-dihydro-1-benzofuran-3-yl]acetic acid |
| InChIKey | UFDNMYNCYATWIB-LURJTMIESA-N |
| SMILES | C1[C@@H](C2=C(O1)C=C(C=C2)Cl)CC(=O)O |
Computed by PubChem (NCBI)