CAS 28458-93-7 is the registry number for Benzo(d)oxazol-2-yl(phenyl)methanone, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g.
1,3-benzoxazol-2-yl(phenyl)methanone (CAS 28458-93-7) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: 1,3-benzoxazol-2-yl(phenyl)methanone. InChIKey: JFBYNWHTOFMZDS-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | 1,3-benzoxazol-2-yl(phenyl)methanone |
| InChIKey | JFBYNWHTOFMZDS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=NC3=CC=CC=C3O2 |
Computed by PubChem (NCBI)