Products 2891598-66-4
CAS 2891598-66-4 is the registry number for methyl 6,8-dichloro-2,7-naphthyridine-3-carboxylate, 94%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Methyl 6,8-dichloro-2,7-naphthyridine-3-carboxylate (CAS 2891598-66-4) is a chemical compound with the molecular formula C10H6Cl2N2O2 and a molecular weight of 257.07 g/mol. IUPAC name: methyl 6,8-dichloro-2,7-naphthyridine-3-carboxylate. InChIKey: IUTRINTWWOTQIE-UHFFFAOYSA-N.
| Molecular formula | C10H6Cl2N2O2 |
|---|---|
| Molecular weight | 257.07 g/mol |
| IUPAC name | methyl 6,8-dichloro-2,7-naphthyridine-3-carboxylate |
| InChIKey | IUTRINTWWOTQIE-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NC=C2C(=C1)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)