Products 2901096-74-8
CAS 2901096-74-8 is the registry number for 2-(2-bromo-3,6-difluorophenyl)-1,3-dioxolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2-bromo-3,6-difluorophenyl)-1,3-dioxolane (CAS 2901096-74-8) is a chemical compound with the molecular formula C9H7BrF2O2 and a molecular weight of 265.05 g/mol. IUPAC name: 2-(2-bromo-3,6-difluorophenyl)-1,3-dioxolane. InChIKey: KRBVUFQXRAHNQT-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF2O2 |
|---|---|
| Molecular weight | 265.05 g/mol |
| IUPAC name | 2-(2-bromo-3,6-difluorophenyl)-1,3-dioxolane |
| InChIKey | KRBVUFQXRAHNQT-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(C=CC(=C2Br)F)F |
Computed by PubChem (NCBI)