Products 2901102-87-0
CAS 2901102-87-0 is the registry number for 2-Fluoro-5-formyl-3-isopropoxybenzoic acid, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-fluoro-5-formyl-3-propan-2-yloxybenzoic acid (CAS 2901102-87-0) is a chemical compound with the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. IUPAC name: 2-fluoro-5-formyl-3-propan-2-yloxybenzoic acid. InChIKey: PHGACOALDHQRLJ-UHFFFAOYSA-N.
| Molecular formula | C11H11FO4 |
|---|---|
| Molecular weight | 226.20 g/mol |
| IUPAC name | 2-fluoro-5-formyl-3-propan-2-yloxybenzoic acid |
| InChIKey | PHGACOALDHQRLJ-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=CC(=CC(=C1F)C(=O)O)C=O |
Computed by PubChem (NCBI)