CAS 29169-63-9 appears in our catalog under these names: Mandelic acid 10, (R)-2-(Formyloxy)-2-phenylacetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-formyloxy-2-phenylacetic acid (CAS 29169-63-9) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 2-formyloxy-2-phenylacetic acid. InChIKey: YFRDJVJDAXMXSQ-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 2-formyloxy-2-phenylacetic acid |
| InChIKey | YFRDJVJDAXMXSQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C(=O)O)OC=O |
Computed by PubChem (NCBI)