Products 2920205-91-8
CAS 2920205-91-8 is the registry number for 1-(tert-Butyl) 3-methyl (3R,5S)-5-aminopiperidine-1,3-dicarboxylate hydrochloride. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
1-O-tert-butyl 3-O-methyl (3R,5S)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride (CAS 2920205-91-8) is a chemical compound with the molecular formula C12H23ClN2O4 and a molecular weight of 294.77 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,5S)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride. InChIKey: OPUPSKVNCAQGFZ-RJUBDTSPSA-N.
| Molecular formula | C12H23ClN2O4 |
|---|---|
| Molecular weight | 294.77 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,5S)-5-aminopiperidine-1,3-dicarboxylate;hydrochloride |
| InChIKey | OPUPSKVNCAQGFZ-RJUBDTSPSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H](C1)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)