Products 2925073-67-0
CAS 2925073-67-0 is the registry number for 1-(2,6-dioxopiperidin-3-yl)-1H-indazole-6-carboxylic acid. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg.
1-(2,6-dioxopiperidin-3-yl)indazole-6-carboxylic acid (CAS 2925073-67-0) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 1-(2,6-dioxopiperidin-3-yl)indazole-6-carboxylic acid. InChIKey: GMDKCWAAPJKXJE-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 1-(2,6-dioxopiperidin-3-yl)indazole-6-carboxylic acid |
| InChIKey | GMDKCWAAPJKXJE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C3=C(C=CC(=C3)C(=O)O)C=N2 |
Computed by PubChem (NCBI)