CAS 2925091-37-6 is the registry number for CRBN ligand-502. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-8-carboxylic acid (CAS 2925091-37-6) is a chemical compound with the molecular formula C14H11N3O4 and a molecular weight of 285.25 g/mol. IUPAC name: 6-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-8-carboxylic acid. InChIKey: QUNITZQKLJOUHX-UHFFFAOYSA-N.
| Molecular formula | C14H11N3O4 |
|---|---|
| Molecular weight | 285.25 g/mol |
| IUPAC name | 6-(2,4-dioxo-1,3-diazinan-1-yl)quinoline-8-carboxylic acid |
| InChIKey | QUNITZQKLJOUHX-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC(=C3C(=C2)C=CC=N3)C(=O)O |
Computed by PubChem (NCBI)