CAS 2925097-55-6 is the registry number for CRBN ligand-538. Offered by: MedChemExpress. Available pack sizes: Get quote.
5-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-3-carboxylic acid (CAS 2925097-55-6) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 5-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-3-carboxylic acid. InChIKey: KDNWKJDMHJNIOM-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 5-(2,4-dioxo-1,3-diazinan-1-yl)-1H-indole-3-carboxylic acid |
| InChIKey | KDNWKJDMHJNIOM-UHFFFAOYSA-N |
| SMILES | C1CN(C(=O)NC1=O)C2=CC3=C(C=C2)NC=C3C(=O)O |
Computed by PubChem (NCBI)