Products 2940-23-0
CAS 2940-23-0 appears in our catalog under these names: 2-(4-Chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid, 95%, 2-(4-Chlorophenyl)-5-methyloxazole-4-carboxylic acid, 97%, 2-(4-Chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg.
2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid (CAS 2940-23-0) is a chemical compound with the molecular formula C11H8ClNO3 and a molecular weight of 237.64 g/mol. IUPAC name: 2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid. InChIKey: VKGNZWBREYZBKG-UHFFFAOYSA-N.
| Molecular formula | C11H8ClNO3 |
|---|---|
| Molecular weight | 237.64 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-5-methyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | VKGNZWBREYZBKG-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(O1)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)