Products 2940858-12-6
CAS 2940858-12-6 is the registry number for (4R)-1-oxa-8-azaspiro[3.5]nonane,hemi(oxalic acid), 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g.
Bis((4R)-1-oxa-8-azaspiro[3.5]nonane);oxalic acid (CAS 2940858-12-6) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: bis((4R)-1-oxa-8-azaspiro[3.5]nonane);oxalic acid. InChIKey: BKJYYZARMVJURT-CTWWJBIBSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | bis((4R)-1-oxa-8-azaspiro[3.5]nonane);oxalic acid |
| InChIKey | BKJYYZARMVJURT-CTWWJBIBSA-N |
| SMILES | C1C[C@@]2(CCO2)CNC1.C1C[C@@]2(CCO2)CNC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)