CAS 637027-24-8 appears in our catalog under these names: (R)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester, 96%, (R)–1,4–di–Boc–piperazine–2–carboxylic acid Methyl ester. Offered by: Combi-blocks, GLPBio. Available pack sizes: 100mg, 5g, 250mg, 1g.
1-O,4-O-ditert-butyl 2-O-methyl (2R)-piperazine-1,2,4-tricarboxylate (CAS 637027-24-8) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 1-O,4-O-ditert-butyl 2-O-methyl (2R)-piperazine-1,2,4-tricarboxylate. InChIKey: QKNSGUCCNZBAAJ-LLVKDONJSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 1-O,4-O-ditert-butyl 2-O-methyl (2R)-piperazine-1,2,4-tricarboxylate |
| InChIKey | QKNSGUCCNZBAAJ-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@H](C1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)