Products 2177259-22-0

CAS 2177259-22-0 appears in our catalog under these names: tert-Butyl1,9-diazaspiro[5.5]undecane-9-carboxylate oxalate, 95%, tert-Butyl1,9-diazaspiro(5.5)undecane-9-carboxylate oxalate, 95%, tert–Butyl 1,9–diazaspiro(5·5)undecane–9–carboxylate oxalate. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 5g, 1g, 100mg.

Structural formula: {0} (CAS {1})

Tert-butyl 1,9-diazaspiro[5.5]undecane-9-carboxylate;oxalic acid (CAS 2177259-22-0) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[5.5]undecane-9-carboxylate;oxalic acid. InChIKey: PFLJSJUAXBJLAY-UHFFFAOYSA-N.

Identity
Molecular formulaC16H28N2O6
Molecular weight344.40 g/mol
IUPAC nametert-butyl 1,9-diazaspiro[5.5]undecane-9-carboxylate;oxalic acid
InChIKeyPFLJSJUAXBJLAY-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCCCN2)CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)