Products 1523606-37-2
CAS 1523606-37-2 appears in our catalog under these names: 6-Oxa-2-azaspiro(3.5)nonane oxalate(2:1), 97%, 6-Oxa-2-azaspiro[3.5]nonane hemioxalate, 95%, 6-oxa-2-azaspiro[3.5]nonane hemioxalate, 97%, 97%. Offered by: AmBeed, Combi-blocks, Chemat. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 100mg, 500mg, 10g.
Bis(6-oxa-2-azaspiro[3.5]nonane);oxalic acid (CAS 1523606-37-2) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: bis(6-oxa-2-azaspiro[3.5]nonane);oxalic acid. InChIKey: FYKVYXCJDKVWQV-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | bis(6-oxa-2-azaspiro[3.5]nonane);oxalic acid |
| InChIKey | FYKVYXCJDKVWQV-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC2)COC1.C1CC2(CNC2)COC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)