CAS 368442-00-6 appears in our catalog under these names: 1,4-Di-boc-2-piperazineacetic acid, 95%, 2–(1,4–Bis(tert–butoxycarbonyl)piperazin–2–yl)acetic acid, 2-(1,4-Bis(tert-butoxycarbonyl)piperazin-2-yl)acetic acid, 98%, 98%, 2-(1,4-BIS(TERT-BUTOXYCARBONYL)PIPERAZIN-2-YL)ACETIC ACID, 98%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
2-[1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid (CAS 368442-00-6) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 2-[1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid. InChIKey: NOSKITKFSSMMRP-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 2-[1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazin-2-yl]acetic acid |
| InChIKey | NOSKITKFSSMMRP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)CC(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)