CAS 1523617-84-6 appears in our catalog under these names: 1-Oxa-7-azaspiro[3.5]nonane hemioxalate, 95%, 1-Oxa-7-azaspiro[3.5]nonane oxalate(2:1) 98%, 1-Oxa-7-azaspiro[3.5]nonane oxalate(2:1), 98%, 98%, 1-Oxa-7-azaspiro[3.5]nonane oxalate(2:1), 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg, 500mg.
Bis(1-oxa-7-azaspiro[3.5]nonane);oxalic acid (CAS 1523617-84-6) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: bis(1-oxa-7-azaspiro[3.5]nonane);oxalic acid. InChIKey: NNCUIWZLZLNKEZ-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | bis(1-oxa-7-azaspiro[3.5]nonane);oxalic acid |
| InChIKey | NNCUIWZLZLNKEZ-UHFFFAOYSA-N |
| SMILES | C1CNCCC12CCO2.C1CNCCC12CCO2.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)