CAS 958635-19-3 appears in our catalog under these names: (S)-1,4-Di-boc-piperazine-2-carboxylic acid methyl ester, 95%, (S)–1,4–Di–tert–butyl 2–methyl piperazine–1,2,4–tricarboxylate, (S)-1,4-Di-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate, 95%, 95%, (S)-1,4-Di-tert-butyl 2-methyl piperazine-1,2,4-tricarboxylate, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
1-O,4-O-ditert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate (CAS 958635-19-3) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 1-O,4-O-ditert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate. InChIKey: QKNSGUCCNZBAAJ-NSHDSACASA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 1-O,4-O-ditert-butyl 2-O-methyl (2S)-piperazine-1,2,4-tricarboxylate |
| InChIKey | QKNSGUCCNZBAAJ-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN([C@@H](C1)C(=O)OC)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)