CAS 1105662-59-6 appears in our catalog under these names: Ethyl 1-boc-3-(boc-amino)azetidine-3-carboxylate, 95%, 1–tert–Butyl 3–ethyl 3–{((tert–butoxy)carbonyl)amino}azetidine–1,3–dicarboxylate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
1-O-tert-butyl 3-O-ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1,3-dicarboxylate (CAS 1105662-59-6) is a chemical compound with the molecular formula C16H28N2O6 and a molecular weight of 344.40 g/mol. IUPAC name: 1-O-tert-butyl 3-O-ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1,3-dicarboxylate. InChIKey: TZJIVIPIMYPLEM-UHFFFAOYSA-N.
| Molecular formula | C16H28N2O6 |
|---|---|
| Molecular weight | 344.40 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-ethyl 3-[(2-methylpropan-2-yl)oxycarbonylamino]azetidine-1,3-dicarboxylate |
| InChIKey | TZJIVIPIMYPLEM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1(CN(C1)C(=O)OC(C)(C)C)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)