CAS 2940875-66-9 is the registry number for (1S,2R)-2-Amino-5,5-difluorocyclohexane-1-carboxylic acid hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 5g, 250mg, 1g.
Cis-(1S,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylic acid;hydrochloride (CAS 2940875-66-9) is a chemical compound with the molecular formula C7H12ClF2NO2 and a molecular weight of 215.62 g/mol. IUPAC name: cis-(1S,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: UJFYKNURJIAUSZ-UYXJWNHNSA-N.
| Molecular formula | C7H12ClF2NO2 |
|---|---|
| Molecular weight | 215.62 g/mol |
| IUPAC name | cis-(1S,2R)-2-amino-5,5-difluorocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | UJFYKNURJIAUSZ-UYXJWNHNSA-N |
| SMILES | C1CC(C[C@@H]([C@@H]1N)C(=O)O)(F)F.Cl |
Computed by PubChem (NCBI)