Products 2963-78-2
CAS 2963-78-2 appears in our catalog under these names: 2-(Butyryloxy)-N,N,N-trimethylethanaminium chloride, 98%, 2-(Butyryloxy)-N,N,N-Trimethylethanaminium Chloride, 98%,RG, Butyrylcholine chloride, Butyrylcholine chloride, Butyrylcholine chloride, 95.00%. Offered by: BLDpharm, Chemat, GLPBio, Biosynth, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g, 50mg, 25g, 50g.
2-butanoyloxyethyl(trimethyl)azanium chloride (CAS 2963-78-2) is a chemical compound with the molecular formula C9H20ClNO2 and a molecular weight of 209.71 g/mol. IUPAC name: 2-butanoyloxyethyl(trimethyl)azanium chloride. InChIKey: VCOBYGVZILHVOO-UHFFFAOYSA-M.
| Molecular formula | C9H20ClNO2 |
|---|---|
| Molecular weight | 209.71 g/mol |
| IUPAC name | 2-butanoyloxyethyl(trimethyl)azanium chloride |
| InChIKey | VCOBYGVZILHVOO-UHFFFAOYSA-M |
| SMILES | CCCC(=O)OCC[N+](C)(C)C.[Cl-] |
Computed by PubChem (NCBI)
Synonyms:
Butyrylcholine chloride, 2-Butyryloxyethyltrimethylammonium chloride, Ethanaminium, N,N,N-trimethyl-2-(1-oxobutoxy)-, chloride, 2-(butyryloxy)-n,n,n-trimethylethanaminium chloride, Butrylcholine chloride, 2-butanoyloxyethyl(trimethyl)azanium;chloride, [2-(butanoyloxy)ethyl]trimethylazanium chloride, Choline, butyrate, Choline, chloride, butyrate, regid855914