CAS 29640-76-4 is the registry number for 3-Acetyldibenzofuran, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g, 25g.
1-dibenzofuran-3-ylethanone (CAS 29640-76-4) is a chemical compound with the molecular formula C14H10O2 and a molecular weight of 210.23 g/mol. IUPAC name: 1-dibenzofuran-3-ylethanone. InChIKey: PAKCFVBCRFPHNN-UHFFFAOYSA-N.
| Molecular formula | C14H10O2 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | 1-dibenzofuran-3-ylethanone |
| InChIKey | PAKCFVBCRFPHNN-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC2=C(C=C1)C3=CC=CC=C3O2 |
Computed by PubChem (NCBI)