Products 2969215-08-3
CAS 2969215-08-3 is the registry number for 5-amino-2,4-dichlorophenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(5-amino-2,4-dichlorophenyl) acetate (CAS 2969215-08-3) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: (5-amino-2,4-dichlorophenyl) acetate. InChIKey: YHJVIZAUKNHVBJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | (5-amino-2,4-dichlorophenyl) acetate |
| InChIKey | YHJVIZAUKNHVBJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C(=C1)N)Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
5-Amino-2,4-dichlorophenyl acetate