CAS 29705-82-6 appears in our catalog under these names: Adrenaline Impurity 7 HCl, Adrenaline Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dihydroxyphenyl)-2-(methylamino)ethanone;hydrochloride (CAS 29705-82-6) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 1-(2,4-dihydroxyphenyl)-2-(methylamino)ethanone;hydrochloride. InChIKey: GJTCVLOGGQXXEC-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 1-(2,4-dihydroxyphenyl)-2-(methylamino)ethanone;hydrochloride |
| InChIKey | GJTCVLOGGQXXEC-UHFFFAOYSA-N |
| SMILES | CNCC(=O)C1=C(C=C(C=C1)O)O.Cl |
Computed by PubChem (NCBI)