CAS 2976-74-1 appears in our catalog under these names: 2,3-Dichlorophenoxyacetic Acid, 2,3-D, 2,3–Dichlorophenoxyacetic acid, (2,3-Dichlorophenoxy)acetic acid 97%, 2,3-DICHLOROPHENOXYACETIC ACID, 98%, 98%. Offered by: TRC, Dr. Ehrenstorfer, GLPBio, Ambeed, Chemat. Available pack sizes: 25g, 500mg, 5g, 100mg, 100g, 1g, 10g.
2-(2,3-dichlorophenoxy)acetic acid (CAS 2976-74-1) is a chemical compound with the molecular formula C8H6Cl2O3 and a molecular weight of 221.03 g/mol. IUPAC name: 2-(2,3-dichlorophenoxy)acetic acid. InChIKey: RBJIGQRZLITQJG-UHFFFAOYSA-N.
| Molecular formula | C8H6Cl2O3 |
|---|---|
| Molecular weight | 221.03 g/mol |
| IUPAC name | 2-(2,3-dichlorophenoxy)acetic acid |
| InChIKey | RBJIGQRZLITQJG-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)OCC(=O)O |
Computed by PubChem (NCBI)