Products 2984470-86-0
CAS 2984470-86-0 is the registry number for Ethyl 2-(2-Amino-1,3-thiazol-4-yl)acetate-15N2,13C Hydrochloride. Offered by: TRC. Available pack sizes: 5mg.
Ethyl 2-(2-(15N)azanyl-(213C,315N)1,3-thiazol-4-yl)acetate;hydrochloride (CAS 2984470-86-0) is a chemical compound with the molecular formula C7H11ClN2O2S and a molecular weight of 225.67 g/mol. IUPAC name: ethyl 2-(2-(15N)azanyl-(213C,315N)1,3-thiazol-4-yl)acetate;hydrochloride. InChIKey: LDNSAJGXLKYTQU-VUEJFPQBSA-N.
| Molecular formula | C7H11ClN2O2S |
|---|---|
| Molecular weight | 225.67 g/mol |
| IUPAC name | ethyl 2-(2-(15N)azanyl-(213C,315N)1,3-thiazol-4-yl)acetate;hydrochloride |
| InChIKey | LDNSAJGXLKYTQU-VUEJFPQBSA-N |
| SMILES | CCOC(=O)CC1=CS[13C](=[15N]1)[15NH2].Cl |
Computed by PubChem (NCBI)