Products 299169-13-4
CAS 299169-13-4 appears in our catalog under these names: 2-Amino-2-(2,4-dichlorophenyl)acetic acid, 2-Amino-2-(2,4-dichlorophenyl)acetic acid, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 5g, 100mg, 250mg, 1g, 10g.
2-amino-2-(2,4-dichlorophenyl)acetic acid (CAS 299169-13-4) is a chemical compound with the molecular formula C8H7Cl2NO2 and a molecular weight of 220.05 g/mol. IUPAC name: 2-amino-2-(2,4-dichlorophenyl)acetic acid. InChIKey: YXUSXKBQYIPZDJ-UHFFFAOYSA-N.
| Molecular formula | C8H7Cl2NO2 |
|---|---|
| Molecular weight | 220.05 g/mol |
| IUPAC name | 2-amino-2-(2,4-dichlorophenyl)acetic acid |
| InChIKey | YXUSXKBQYIPZDJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(C(=O)O)N |
Computed by PubChem (NCBI)