Products 3017241-96-9
CAS 3017241-96-9 is the registry number for tert-Butyl 3-oxo-1,3-dihydro-2-benzofuran-5-carboxylate, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
Tert-butyl 3-oxo-1H-2-benzofuran-5-carboxylate (CAS 3017241-96-9) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: tert-butyl 3-oxo-1H-2-benzofuran-5-carboxylate. InChIKey: HUPJSFIEDOZWIW-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | tert-butyl 3-oxo-1H-2-benzofuran-5-carboxylate |
| InChIKey | HUPJSFIEDOZWIW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC2=C(COC2=O)C=C1 |
Computed by PubChem (NCBI)