Products 3028149-29-0
CAS 3028149-29-0 is the registry number for 2,6-diazaspiro[3.5]nonan-5-one, trifluoroacetic acid, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
2,6-diazaspiro[3.5]nonan-5-one;2,2,2-trifluoroacetic acid (CAS 3028149-29-0) is a chemical compound with the molecular formula C9H13F3N2O3 and a molecular weight of 254.21 g/mol. IUPAC name: 2,6-diazaspiro[3.5]nonan-5-one;2,2,2-trifluoroacetic acid. InChIKey: HDEQUQWHMWJZGD-UHFFFAOYSA-N.
| Molecular formula | C9H13F3N2O3 |
|---|---|
| Molecular weight | 254.21 g/mol |
| IUPAC name | 2,6-diazaspiro[3.5]nonan-5-one;2,2,2-trifluoroacetic acid |
| InChIKey | HDEQUQWHMWJZGD-UHFFFAOYSA-N |
| SMILES | C1CC2(CNC2)C(=O)NC1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)