CAS 304448-91-7 is the registry number for 2-(Furan-2-amido)benzoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(furan-2-carbonylamino)benzoic acid (CAS 304448-91-7) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 2-(furan-2-carbonylamino)benzoic acid. InChIKey: KGUJFARQLOGYHU-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 2-(furan-2-carbonylamino)benzoic acid |
| InChIKey | KGUJFARQLOGYHU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)O)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)