Products 3064070-24-9
CAS 3064070-24-9 is the registry number for 8BTC. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-(4,5-dichloro-2,3-dihydroindol-1-yl)ethanone (CAS 3064070-24-9) is a chemical compound with the molecular formula C10H9Cl2NO and a molecular weight of 230.09 g/mol. IUPAC name: 1-(4,5-dichloro-2,3-dihydroindol-1-yl)ethanone. InChIKey: FSLARAPYXMNEFP-UHFFFAOYSA-N.
| Molecular formula | C10H9Cl2NO |
|---|---|
| Molecular weight | 230.09 g/mol |
| IUPAC name | 1-(4,5-dichloro-2,3-dihydroindol-1-yl)ethanone |
| InChIKey | FSLARAPYXMNEFP-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCC2=C1C=CC(=C2Cl)Cl |
Computed by PubChem (NCBI)