CAS 69515-91-9 appears in our catalog under these names: 2-Deoxy-D-glucose Tetraacetate, >95% (HPLC), 1,3,4,6-Tetra-O-acetyl-2-deoxy-D-glucopyranose, 2-Deoxy-D-glucose-tetraacetate. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 1g, 2g, 5g, 1000mg, 500mg, 2000mg, 10000mg, 5000mg.
[(2R,3S,4R)-3,4,6-triacetyloxyoxan-2-yl]methyl acetate (CAS 69515-91-9) is a chemical compound with the molecular formula C14H20O9 and a molecular weight of 332.30 g/mol. IUPAC name: [(2R,3S,4R)-3,4,6-triacetyloxyoxan-2-yl]methyl acetate. InChIKey: KLEORKVJPIJWNG-VMXNZORSSA-N.
| Molecular formula | C14H20O9 |
|---|---|
| Molecular weight | 332.30 g/mol |
| IUPAC name | [(2R,3S,4R)-3,4,6-triacetyloxyoxan-2-yl]methyl acetate |
| InChIKey | KLEORKVJPIJWNG-VMXNZORSSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H](CC(O1)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)