CAS 30845-11-5 appears in our catalog under these names: S-(3-Carboxypropyl)-L-cysteine, >95% (HPLC), H-Cys(3-Carboxypropyl)-OH 98%, (R)-4-((2-Amino-2-carboxyethyl)thio)butanoic acid, 98%, 98%, S-(3-Carboxypropyl)-L-cysteine, 98%. Offered by: TRC, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 5g.
4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid (CAS 30845-11-5) is a chemical compound with the molecular formula C7H13NO4S and a molecular weight of 207.25 g/mol. IUPAC name: 4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid. InChIKey: WNFNRNDFHINZLV-YFKPBYRVSA-N.
| Molecular formula | C7H13NO4S |
|---|---|
| Molecular weight | 207.25 g/mol |
| IUPAC name | 4-[(2R)-2-amino-2-carboxyethyl]sulfanylbutanoic acid |
| InChIKey | WNFNRNDFHINZLV-YFKPBYRVSA-N |
| SMILES | C(CC(=O)O)CSC[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)