CAS 31327-97-6 appears in our catalog under these names: Acridine-4-carboxylic acid 98%, Acridine-4-carboxylic acid, 98%, 98%, 4-Acridinecarboxylic acid, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Acridine-4-carboxylic acid (CAS 31327-97-6) is a chemical compound with the molecular formula C14H9NO2 and a molecular weight of 223.23 g/mol. IUPAC name: acridine-4-carboxylic acid. InChIKey: NBIUCDPMOWCGIG-UHFFFAOYSA-N.
| Molecular formula | C14H9NO2 |
|---|---|
| Molecular weight | 223.23 g/mol |
| IUPAC name | acridine-4-carboxylic acid |
| InChIKey | NBIUCDPMOWCGIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C3C=CC=C(C3=N2)C(=O)O |
Computed by PubChem (NCBI)