Products 313545-31-2
CAS 313545-31-2 appears in our catalog under these names: 4-Ethoxy-2-methylphenylboronic acid, 98%, B-(4-Ethoxy-2-methylphenyl)boronic acid 98%, 4–Ethoxy–2–methylphenylboronic Acid (contains varying amounts of Anhydride), 4-Ethoxy-2-methylphenylboronic Acid (contains varying amounts of Anhydride), B-(4-Ethoxy-2-methylphenyl)boronic acid, 98%, 98%. Offered by: Fluorochem, Ambeed, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 250mg.
(4-ethoxy-2-methylphenyl)boronic acid (CAS 313545-31-2) is a chemical compound with the molecular formula C9H13BO3 and a molecular weight of 180.01 g/mol. IUPAC name: (4-ethoxy-2-methylphenyl)boronic acid. InChIKey: MBEQXBKSJCOKJF-UHFFFAOYSA-N.
| Molecular formula | C9H13BO3 |
|---|---|
| Molecular weight | 180.01 g/mol |
| IUPAC name | (4-ethoxy-2-methylphenyl)boronic acid |
| InChIKey | MBEQXBKSJCOKJF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OCC)C)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Ethoxy-2-methylphenylboronic acid, (4-ethoxy-2-methylphenyl)boronic acid, B-(4-Ethoxy-2-methylphenyl)boronic acid, 4-Ethoxy-2-methylphenylboronic Acid (contains varying amounts of Anhydride), (4-ethoxy-2-methyl-phenyl)boronic acid, MBEQXBKSJCOKJF-UHFFFAOYSA-N, 2-methyl-4-ethoxybenzene boronic acid, B-(4-Ethoxy-2-methylphenyl)boronicacid