Products 32228-99-2
CAS 32228-99-2 appears in our catalog under these names: N-Phenyl-4-biphenylamine, N–Phenyl–4–biphenylamine, N-Phenyl-4-biphenylamine, >98.0%(GC), 4-Anilinobiphenyl 95%, N-Phenyl-[1,1'-biphenyl]-4-amine, 95%, 95%. Offered by: TRC, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10mg, 50mg, 5mg, 1g, 5g, 500mg, 10g, 25g.
N,4-diphenylaniline (CAS 32228-99-2) is a chemical compound with the molecular formula C18H15N and a molecular weight of 245.3 g/mol. IUPAC name: N,4-diphenylaniline. InChIKey: YGNUPJXMDOFFDO-UHFFFAOYSA-N.
| Molecular formula | C18H15N |
|---|---|
| Molecular weight | 245.3 g/mol |
| IUPAC name | N,4-diphenylaniline |
| InChIKey | YGNUPJXMDOFFDO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NC3=CC=CC=C3 |
Computed by PubChem (NCBI)
Synonyms:
N-Phenyl-[1,1'-biphenyl]-4-amine, N-phenyl-(1,1'-biphenyl)-4-amine, N-Phenyl-4-biphenylamine, 4-Anilinobiphenyl, N-phenylbiphenyl-4-amine, [1,1'-Biphenyl]-4-amine, N-phenyl-, N-Phenyl-[1,1'-biphenyl]-4-amine;N-phenyl-1,1'-biphenyl-4-amine, 4-Anilinobipheny, 4-(Phenylamino)biphenyl, (Biphenyl-4-yl)-phenylamine