CAS 3227-09-6 is the registry number for H–Ser–Met–OH. Offered by: GLPBio. Available pack sizes: 1g, 5g.
(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoic acid (CAS 3227-09-6) is a chemical compound with the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. IUPAC name: (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoic acid. InChIKey: PBUXMVYWOSKHMF-WDSKDSINSA-N.
| Molecular formula | C8H16N2O4S |
|---|---|
| Molecular weight | 236.29 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-4-methylsulfanylbutanoic acid |
| InChIKey | PBUXMVYWOSKHMF-WDSKDSINSA-N |
| SMILES | CSCC[C@@H](C(=O)O)NC(=O)[C@H](CO)N |
Computed by PubChem (NCBI)