Products 32338-22-0
CAS 32338-22-0 is the registry number for 2-(3-Aminophenyl)-2,3-dihydro-1H-isoindole-1,3-dione. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(3-aminophenyl)isoindole-1,3-dione (CAS 32338-22-0) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 2-(3-aminophenyl)isoindole-1,3-dione. InChIKey: OOPLRJVJUNAQIG-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 2-(3-aminophenyl)isoindole-1,3-dione |
| InChIKey | OOPLRJVJUNAQIG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N(C2=O)C3=CC=CC(=C3)N |
Computed by PubChem (NCBI)