CAS 3238-20-8 is the registry number for (1-Bromo-3,3,3-trifluoropropyl)benzene. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
(1-bromo-3,3,3-trifluoropropyl)benzene (CAS 3238-20-8) is a chemical compound with the molecular formula C9H8BrF3 and a molecular weight of 253.06 g/mol. IUPAC name: (1-bromo-3,3,3-trifluoropropyl)benzene. InChIKey: AYKUFAYXLNQFMV-UHFFFAOYSA-N.
| Molecular formula | C9H8BrF3 |
|---|---|
| Molecular weight | 253.06 g/mol |
| IUPAC name | (1-bromo-3,3,3-trifluoropropyl)benzene |
| InChIKey | AYKUFAYXLNQFMV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CC(F)(F)F)Br |
Computed by PubChem (NCBI)