CAS 326-56-7 appears in our catalog under these names: Methyl 1,3-benzodioxole-5-carboxylate, 98%, Methyl benzo(d)(1,3)dioxole-5-carboxylate, Methyl benzo[d][1,3]dioxole-5-carboxylate, 97%, 97%, Methyl benzo[d][1,3]dioxole-5-carboxylate, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 1g, 5g, 100mg, 250mg.
Methyl 1,3-benzodioxole-5-carboxylate (CAS 326-56-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: methyl 1,3-benzodioxole-5-carboxylate. InChIKey: QCHGUEIECOASJU-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | methyl 1,3-benzodioxole-5-carboxylate |
| InChIKey | QCHGUEIECOASJU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)OCO2 |
Computed by PubChem (NCBI)