CAS 327056-74-6 is the registry number for 3-Cyano-5-fluorobenzoic acid, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g.
3-cyano-5-fluorobenzoic acid (CAS 327056-74-6) is a chemical compound with the molecular formula C8H4FNO2 and a molecular weight of 165.12 g/mol. IUPAC name: 3-cyano-5-fluorobenzoic acid. InChIKey: HADZSOZVTCEMNP-UHFFFAOYSA-N.
| Molecular formula | C8H4FNO2 |
|---|---|
| Molecular weight | 165.12 g/mol |
| IUPAC name | 3-cyano-5-fluorobenzoic acid |
| InChIKey | HADZSOZVTCEMNP-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)O)F)C#N |
Computed by PubChem (NCBI)