CAS 329205-51-8 is the registry number for N-(Benzo[d][1,3]dioxol-5-yl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(1,3-benzodioxol-5-yl)furan-2-carboxamide (CAS 329205-51-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: N-(1,3-benzodioxol-5-yl)furan-2-carboxamide. InChIKey: XTZQUUFEQWTGNT-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | N-(1,3-benzodioxol-5-yl)furan-2-carboxamide |
| InChIKey | XTZQUUFEQWTGNT-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)NC(=O)C3=CC=CO3 |
Computed by PubChem (NCBI)