CAS 3307-41-3 appears in our catalog under these names: 2-(3,4-Dichlorophenoxy)propanoic acid, 97%, 97%, 2-(3,4-Dichlorophenoxy)propanoic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 2.5g, 10g.
2-(3,4-dichlorophenoxy)propanoic acid (CAS 3307-41-3) is a chemical compound with the molecular formula C9H8Cl2O3 and a molecular weight of 235.06 g/mol. IUPAC name: 2-(3,4-dichlorophenoxy)propanoic acid. InChIKey: BIPAGODSEBNAJR-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O3 |
|---|---|
| Molecular weight | 235.06 g/mol |
| IUPAC name | 2-(3,4-dichlorophenoxy)propanoic acid |
| InChIKey | BIPAGODSEBNAJR-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)OC1=CC(=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)