Products 33208-47-8
CAS 33208-47-8 appears in our catalog under these names: 1,6:2,3-Dianhydro-4-O-benzyl-b-D-mannopyranose, 1,6:2,3-Dianhydro-4-O-benzyl-β-D-mannopyranose. Offered by: Biosynth, Chemat. Available pack sizes: 2g, 1g, 100mg, 250mg, 500mg, 50mg, 5g.
(1R,2S,4S,5R,6R)-5-phenylmethoxy-3,8,9-trioxatricyclo[4.2.1.02,4]nonane (CAS 33208-47-8) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: (1R,2S,4S,5R,6R)-5-phenylmethoxy-3,8,9-trioxatricyclo[4.2.1.02,4]nonane. InChIKey: YVZYNXNBLFZJNU-NAWOPXAZSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (1R,2S,4S,5R,6R)-5-phenylmethoxy-3,8,9-trioxatricyclo[4.2.1.02,4]nonane |
| InChIKey | YVZYNXNBLFZJNU-NAWOPXAZSA-N |
| SMILES | C1[C@@H]2[C@H]([C@H]3[C@H](O3)[C@H](O1)O2)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)