CAS 33321-39-0 appears in our catalog under these names: 2-(3-(Aminomethyl)phenoxy)acetic acid hydrochloride, 95%, 2-(3-(Aminomethyl)phenoxy)acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-[3-(aminomethyl)phenoxy]acetic acid;hydrochloride (CAS 33321-39-0) is a chemical compound with the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. IUPAC name: 2-[3-(aminomethyl)phenoxy]acetic acid;hydrochloride. InChIKey: GZACWUMYWHAFEN-UHFFFAOYSA-N.
| Molecular formula | C9H12ClNO3 |
|---|---|
| Molecular weight | 217.65 g/mol |
| IUPAC name | 2-[3-(aminomethyl)phenoxy]acetic acid;hydrochloride |
| InChIKey | GZACWUMYWHAFEN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)OCC(=O)O)CN.Cl |
Computed by PubChem (NCBI)