Products 3347-99-7
CAS 3347-99-7 appears in our catalog under these names: 4-Methylisophthalic acid, 96%, 4–Methylisophthalic acid, 4-Methylisophthalic acid, 4-Methylisophthalic acid, 97%, 97%, 4-Methylisophthalic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 250mg, 25g, 1g, 5g, 100mg, 2,5g, 500mg.
4-methylbenzene-1,3-dicarboxylic acid (CAS 3347-99-7) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 4-methylbenzene-1,3-dicarboxylic acid. InChIKey: PNWSHHILERSSLF-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-methylbenzene-1,3-dicarboxylic acid |
| InChIKey | PNWSHHILERSSLF-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)