CAS 3402-70-8 appears in our catalog under these names: 4-Methylphenyl 2-nitrophenyl ether, 95-<97%, 1-nitro-2-(p-tolyloxy)benzene, 95%, 95%. Offered by: Hoffman Fine Chemicals, Chemat. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100mg, 250mg, 1g.
1-(4-methylphenoxy)-2-nitrobenzene (CAS 3402-70-8) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 1-(4-methylphenoxy)-2-nitrobenzene. InChIKey: OSDQXPIRKIRPDH-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-(4-methylphenoxy)-2-nitrobenzene |
| InChIKey | OSDQXPIRKIRPDH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=CC=C2[N+](=O)[O-] |
Computed by PubChem (NCBI)