CAS 342386-78-1 appears in our catalog under these names: 1–(3,4–Dichlorophenyl)cyclopropane–1–carboxylic acid, 1-(3,4-Dichlorophenyl)cyclopropane-1-carboxylic acid, 95%, 1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid, 1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid, 98%, 1-(3,4-Dichlorophenyl)cyclopropanecarboxylic acid, 98%, 98%. Offered by: GLPBio, Fluorochem, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg.
1-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 342386-78-1) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: VNBCEUVYNYCYBW-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | VNBCEUVYNYCYBW-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)